C17H16N4O3 — CID 89376125
N-diazenyl-N-(3-oxo-3-phenylpropyl)-1,3-benzodioxole-5-carboximidamide (PubChem CID 89376125) has the molecular formula C17H16N4O3 and a molecular weight of 324.34 g/mol. Its IUPAC name is N-diazenyl-N-(3-oxo-3-phenylpropyl)-1,3-benzodioxole-5-carboximidamide.
| Compound Name | N-diazenyl-N-(3-oxo-3-phenylpropyl)-1,3-benzodioxole-5-carboximidamide |
|---|---|
| PubChem CID | 89376125 |
| Molecular Formula | C17H16N4O3 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | N-diazenyl-N-(3-oxo-3-phenylpropyl)-1,3-benzodioxole-5-carboximidamide |
| SMILES | [H]/N=C(/c1ccc2c(c1)OCO2)N(CCC(=O)c1ccccc1)/N=N/[H] |
| InChI | InChI=1S/C17H16N4O3/c18-17(13-6-7-15-16(10-13)24-11-23-15)21(20-19)9-8-14(22)12-4-2-1-3-5-12/h1-7,10,18-19H,8-9,11H2/b18-17-,20-19+ |
| InChIKey | AVYQFAQRVFZVGM-SCMBIPALSA-N |
| XLogP | 3.26 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|