C17H14F3N2O4- — CID 8972331
2,3-dimethoxy-6-[(Z)-[[2-(trifluoromethyl)phenyl]hydrazinylidene]methyl]benzoate (PubChem CID 8972331) has the molecular formula C17H14F3N2O4- and a molecular weight of 367.30 g/mol. Its IUPAC name is 2,3-dimethoxy-6-[(Z)-[[2-(trifluoromethyl)phenyl]hydrazinylidene]methyl]benzoate.
| Compound Name | 2,3-dimethoxy-6-[(Z)-[[2-(trifluoromethyl)phenyl]hydrazinylidene]methyl]benzoate |
|---|---|
| PubChem CID | 8972331 |
| Molecular Formula | C17H14F3N2O4- |
| Molecular Weight | 367.30 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 2,3-dimethoxy-6-[(Z)-[[2-(trifluoromethyl)phenyl]hydrazinylidene]methyl]benzoate |
| SMILES | COc1ccc(/C=N\Nc2ccccc2C(F)(F)F)c(C(=O)[O-])c1OC |
| InChI | InChI=1S/C17H15F3N2O4/c1-25-13-8-7-10(14(16(23)24)15(13)26-2)9-21-22-12-6-4-3-5-11(12)17(18,19)20/h3-9,22H,1-2H3,(H,23,24)/p-1/b21-9- |
| InChIKey | LOTXIBFVHIJBMW-NKVSQWTQSA-M |
| XLogP | 2.53 |
| TPSA | 82.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|