C14H19F14P — CID 90212328
methyl-(3,3,4,4,4-pentafluorobutyl)-tris(3,3,3-trifluoropropyl)-λ5-phosphane (PubChem CID 90212328) has the molecular formula C14H19F14P and a molecular weight of 484.25 g/mol. Its IUPAC name is methyl-(3,3,4,4,4-pentafluorobutyl)-tris(3,3,3-trifluoropropyl)-λ5-phosphane.
| Compound Name | methyl-(3,3,4,4,4-pentafluorobutyl)-tris(3,3,3-trifluoropropyl)-λ5-phosphane |
|---|---|
| PubChem CID | 90212328 |
| Molecular Formula | C14H19F14P |
| Molecular Weight | 484.25 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | methyl-(3,3,4,4,4-pentafluorobutyl)-tris(3,3,3-trifluoropropyl)-λ5-phosphane |
| SMILES | CP(CCC(F)(F)F)(CCC(F)(F)F)(CCC(F)(F)F)CCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H19F14P/c1-29(7-3-11(17,18)19,8-4-12(20,21)22,9-5-13(23,24)25)6-2-10(15,16)14(26,27)28/h2-9H2,1H3 |
| InChIKey | MTQOYLSBFJHVBT-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.25 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|