About (E)-but-2-enedioate;hydron;2-methylbutan-2-ylazanium
(E)-but-2-enedioate;hydron;2-methylbutan-2-ylazanium (PubChem CID 90239573) has the molecular formula C9H17NO4
and a molecular weight of 203.24 g/mol. Its IUPAC name is (E)-but-2-enedioate;hydron;2-methylbutan-2-ylazanium.
Molecular Properties
| Compound Name | (E)-but-2-enedioate;hydron;2-methylbutan-2-ylazanium |
| PubChem CID | 90239573 |
| Molecular Formula | C9H17NO4 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | (E)-but-2-enedioate;hydron;2-methylbutan-2-ylazanium |
| SMILES | CCC(C)(C)[NH3+].O=C([O-])/C=C/C(=O)[O-].[H+] |
| InChI | InChI=1S/C5H13N.C4H4O4/c1-4-5(2,3)6;5-3(6)1-2-4(7)8/h4,6H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | JMVZMDGLIJEIPK-WLHGVMLRSA-N |
| XLogP | -2.43 |
| TPSA | 107.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-but-2-enedioate;hydron;2-methylbutan-2-ylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-but-2-enedioate;hydron;2-methylbutan-2-ylazanium?
The IUPAC name of (E)-but-2-enedioate;hydron;2-methylbutan-2-ylazanium (CID 90239573) is (E)-but-2-enedioate;hydron;2-methylbutan-2-ylazanium.
What is the SMILES notation for (E)-but-2-enedioate;hydron;2-methylbutan-2-ylazanium?
The canonical SMILES for (E)-but-2-enedioate;hydron;2-methylbutan-2-ylazanium is CCC(C)(C)[NH3+].O=C([O-])/C=C/C(=O)[O-].[H+].
What is the InChIKey of (E)-but-2-enedioate;hydron;2-methylbutan-2-ylazanium?
The InChIKey is JMVZMDGLIJEIPK-WLHGVMLRSA-N. The full InChI is InChI=1S/C5H13N.C4H4O4/c1-4-5(2,3)6;5-3(6)1-2-4(7)8/h4,6H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1+.
What are the key properties of (E)-but-2-enedioate;hydron;2-methylbutan-2-ylazanium?
(E)-but-2-enedioate;hydron;2-methylbutan-2-ylazanium has a molecular weight of 203.24 g/mol, XLogP of -2.43, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-but-2-enedioate;hydron;2-methylbutan-2-ylazanium is sourced from PubChem (CID 90239573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).