C14H18O3 — CID 902842
(5R,7S)-3,3,11-trimethyl-2,6-dioxatricyclo[7.3.1.05,13]trideca-1(12),9(13),10-trien-7-ol (PubChem CID 902842) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is (5R,7S)-3,3,11-trimethyl-2,6-dioxatricyclo[7.3.1.05,13]trideca-1(12),9(13),10-trien-7-ol.
| Compound Name | (5R,7S)-3,3,11-trimethyl-2,6-dioxatricyclo[7.3.1.05,13]trideca-1(12),9(13),10-trien-7-ol |
|---|---|
| PubChem CID | 902842 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (5R,7S)-3,3,11-trimethyl-2,6-dioxatricyclo[7.3.1.05,13]trideca-1(12),9(13),10-trien-7-ol |
| SMILES | Cc1cc2c3c(c1)OC(C)(C)C[C@H]3O[C@H](O)C2 |
| InChI | InChI=1S/C14H18O3/c1-8-4-9-6-12(15)16-11-7-14(2,3)17-10(5-8)13(9)11/h4-5,11-12,15H,6-7H2,1-3H3/t11-,12+/m1/s1 |
| InChIKey | WJLUOWDYLPRKTC-NEPJUHHUSA-N |
| XLogP | 2.49 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |