C23H32O5Si — CID 90305083
(2S,3R,4S)-4-[tert-butyl(diphenyl)silyl]oxy-5,5-bis(hydroxymethyl)-2-methyloxolan-3-ol (PubChem CID 90305083) has the molecular formula C23H32O5Si and a molecular weight of 416.59 g/mol. Its IUPAC name is (2S,3R,4S)-4-[tert-butyl(diphenyl)silyl]oxy-5,5-bis(hydroxymethyl)-2-methyloxolan-3-ol.
| Compound Name | (2S,3R,4S)-4-[tert-butyl(diphenyl)silyl]oxy-5,5-bis(hydroxymethyl)-2-methyloxolan-3-ol |
|---|---|
| PubChem CID | 90305083 |
| Molecular Formula | C23H32O5Si |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | (2S,3R,4S)-4-[tert-butyl(diphenyl)silyl]oxy-5,5-bis(hydroxymethyl)-2-methyloxolan-3-ol |
| SMILES | C[C@@H]1OC(CO)(CO)[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H]1O |
| InChI | InChI=1S/C23H32O5Si/c1-17-20(26)21(23(15-24,16-25)27-17)28-29(22(2,3)4,18-11-7-5-8-12-18)19-13-9-6-10-14-19/h5-14,17,20-21,24-26H,15-16H2,1-4H3/t17-,20+,21-/m0/s1 |
| InChIKey | XUICJRBKDDWLAF-WMQCIHAUSA-N |
| XLogP | 1.43 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|