C22H28O5Si — CID 102370001
(2R,4R,5R,6R)-6-[tert-butyl(diphenyl)silyl]oxy-4,5-dihydroxy-2-methyloxan-3-one (PubChem CID 102370001) has the molecular formula C22H28O5Si and a molecular weight of 400.55 g/mol. Its IUPAC name is (2R,4R,5R,6R)-6-[tert-butyl(diphenyl)silyl]oxy-4,5-dihydroxy-2-methyloxan-3-one.
| Compound Name | (2R,4R,5R,6R)-6-[tert-butyl(diphenyl)silyl]oxy-4,5-dihydroxy-2-methyloxan-3-one |
|---|---|
| PubChem CID | 102370001 |
| Molecular Formula | C22H28O5Si |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | (2R,4R,5R,6R)-6-[tert-butyl(diphenyl)silyl]oxy-4,5-dihydroxy-2-methyloxan-3-one |
| SMILES | C[C@H]1O[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H](O)[C@@H](O)C1=O |
| InChI | InChI=1S/C22H28O5Si/c1-15-18(23)19(24)20(25)21(26-15)27-28(22(2,3)4,16-11-7-5-8-12-16)17-13-9-6-10-14-17/h5-15,19-21,24-25H,1-4H3/t15-,19+,20-,21-/m1/s1 |
| InChIKey | RWAFRLSNRAQYJK-CGRMTHRGSA-N |
| XLogP | 1.60 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|