C29H40ClFN4O5 — CID 90377275
3-[2-(4-chloro-N-ethyl-2-fluoroanilino)ethyl-methylamino]-1-[4-[3-(2-methylpropoxy)-4-nitrophenoxy]piperidin-1-yl]propan-1-one (PubChem CID 90377275) has the molecular formula C29H40ClFN4O5 and a molecular weight of 579.11 g/mol. Its IUPAC name is 3-[2-(4-chloro-N-ethyl-2-fluoroanilino)ethyl-methylamino]-1-[4-[3-(2-methylpropoxy)-4-nitrophenoxy]piperidin-1-yl]propan-1-one.
| Compound Name | 3-[2-(4-chloro-N-ethyl-2-fluoroanilino)ethyl-methylamino]-1-[4-[3-(2-methylpropoxy)-4-nitrophenoxy]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 90377275 |
| Molecular Formula | C29H40ClFN4O5 |
| Molecular Weight | 579.11 g/mol |
| Exact Mass | 578.27 |
| IUPAC Name | 3-[2-(4-chloro-N-ethyl-2-fluoroanilino)ethyl-methylamino]-1-[4-[3-(2-methylpropoxy)-4-nitrophenoxy]piperidin-1-yl]propan-1-one |
| SMILES | CCN(CCN(C)CCC(=O)N1CCC(Oc2ccc([N+](=O)[O-])c(OCC(C)C)c2)CC1)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C29H40ClFN4O5/c1-5-33(26-8-6-22(30)18-25(26)31)17-16-32(4)13-12-29(36)34-14-10-23(11-15-34)40-24-7-9-27(35(37)38)28(19-24)39-20-21(2)3/h6-9,18-19,21,23H,5,10-17,20H2,1-4H3 |
| InChIKey | ZMFGKTBWLPBJDY-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 88.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.11 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|