C25H30BrN5O2 — CID 90696800
2-[(3aS,6S,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-1-(3-bromophenyl)-3-cyanoguanidine (PubChem CID 90696800) has the molecular formula C25H30BrN5O2 and a molecular weight of 512.45 g/mol. Its IUPAC name is 2-[(3aS,6S,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-1-(3-bromophenyl)-3-cyanoguanidine.
| Compound Name | 2-[(3aS,6S,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-1-(3-bromophenyl)-3-cyanoguanidine |
|---|---|
| PubChem CID | 90696800 |
| Molecular Formula | C25H30BrN5O2 |
| Molecular Weight | 512.45 g/mol |
| Exact Mass | 511.16 |
| IUPAC Name | 2-[(3aS,6S,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-1-(3-bromophenyl)-3-cyanoguanidine |
| SMILES | COc1ccc([C@@]23CC[C@H](/N=C(\NC#N)Nc4cccc(Br)c4)C[C@H]2N(C)CC3)cc1OC |
| InChI | InChI=1S/C25H30BrN5O2/c1-31-12-11-25(17-7-8-21(32-2)22(13-17)33-3)10-9-20(15-23(25)31)30-24(28-16-27)29-19-6-4-5-18(26)14-19/h4-8,13-14,20,23H,9-12,15H2,1-3H3,(H2,28,29,30)/t20-,23+,25-/m0/s1 |
| InChIKey | KMWKZMRPHXFDHG-ZWSUVBHBSA-N |
| XLogP | 4.50 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.45 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|