C28H30ClF6N5O4 — CID 87980107
2-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-1-[4-chloro-3-(trifluoromethyl)phenyl]-3-cyanoguanidine;2,2,2-trifluoroacetic acid (PubChem CID 87980107) has the molecular formula C28H30ClF6N5O4 and a molecular weight of 650.02 g/mol. Its IUPAC name is 2-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-1-[4-chloro-3-(trifluoromethyl)phenyl]-3-cyanoguanidine;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-1-[4-chloro-3-(trifluoromethyl)phenyl]-3-cyanoguanidine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87980107 |
| Molecular Formula | C28H30ClF6N5O4 |
| Molecular Weight | 650.02 g/mol |
| Exact Mass | 649.19 |
| IUPAC Name | 2-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-1-[4-chloro-3-(trifluoromethyl)phenyl]-3-cyanoguanidine;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc([C@@]23CC[C@@H](/N=C(\NC#N)Nc4ccc(Cl)c(C(F)(F)F)c4)C[C@@H]2N(C)CC3)cc1OC.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H29ClF3N5O2.C2HF3O2/c1-35-11-10-25(16-4-7-21(36-2)22(12-16)37-3)9-8-18(14-23(25)35)34-24(32-15-31)33-17-5-6-20(27)19(13-17)26(28,29)30;3-2(4,5)1(6)7/h4-7,12-13,18,23H,8-11,14H2,1-3H3,(H2,32,33,34);(H,6,7)/t18-,23+,25+;/m1./s1 |
| InChIKey | WOEYVQYEQCLCKN-IABGVJQNSA-N |
| XLogP | 6.04 |
| TPSA | 119.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.02 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|