About N-(2-aminoethyl)hexa-1,3,5-triene-3-sulfonamide
N-(2-aminoethyl)hexa-1,3,5-triene-3-sulfonamide (PubChem CID 90732079) has the molecular formula C8H14N2O2S
and a molecular weight of 202.28 g/mol. Its IUPAC name is N-(2-aminoethyl)hexa-1,3,5-triene-3-sulfonamide.
Molecular Properties
| Compound Name | N-(2-aminoethyl)hexa-1,3,5-triene-3-sulfonamide |
| PubChem CID | 90732079 |
| Molecular Formula | C8H14N2O2S |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | N-(2-aminoethyl)hexa-1,3,5-triene-3-sulfonamide |
| SMILES | C=CC=C(C=C)S(=O)(=O)NCCN |
| InChI | InChI=1S/C8H14N2O2S/c1-3-5-8(4-2)13(11,12)10-7-6-9/h3-5,10H,1-2,6-7,9H2 |
| InChIKey | IPHJMABRSFGJMY-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-(2-aminoethyl)hexa-1,3,5-triene-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminoethyl)hexa-1,3,5-triene-3-sulfonamide?
The IUPAC name of N-(2-aminoethyl)hexa-1,3,5-triene-3-sulfonamide (CID 90732079) is N-(2-aminoethyl)hexa-1,3,5-triene-3-sulfonamide.
What is the SMILES notation for N-(2-aminoethyl)hexa-1,3,5-triene-3-sulfonamide?
The canonical SMILES for N-(2-aminoethyl)hexa-1,3,5-triene-3-sulfonamide is C=CC=C(C=C)S(=O)(=O)NCCN.
What is the InChIKey of N-(2-aminoethyl)hexa-1,3,5-triene-3-sulfonamide?
The InChIKey is IPHJMABRSFGJMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O2S/c1-3-5-8(4-2)13(11,12)10-7-6-9/h3-5,10H,1-2,6-7,9H2.
What are the key properties of N-(2-aminoethyl)hexa-1,3,5-triene-3-sulfonamide?
N-(2-aminoethyl)hexa-1,3,5-triene-3-sulfonamide has a molecular weight of 202.28 g/mol, XLogP of 0.12, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminoethyl)hexa-1,3,5-triene-3-sulfonamide is sourced from PubChem (CID 90732079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).