C24H27F2N3O3 — CID 90791129
1-(3,4-difluorophenyl)-3-[(1S,10S,12R)-4,5-dimethoxy-9-azatetracyclo[7.5.2.01,10.02,7]hexadeca-2,4,6-trien-12-yl]urea (PubChem CID 90791129) has the molecular formula C24H27F2N3O3 and a molecular weight of 443.49 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-3-[(1S,10S,12R)-4,5-dimethoxy-9-azatetracyclo[7.5.2.01,10.02,7]hexadeca-2,4,6-trien-12-yl]urea.
| Compound Name | 1-(3,4-difluorophenyl)-3-[(1S,10S,12R)-4,5-dimethoxy-9-azatetracyclo[7.5.2.01,10.02,7]hexadeca-2,4,6-trien-12-yl]urea |
|---|---|
| PubChem CID | 90791129 |
| Molecular Formula | C24H27F2N3O3 |
| Molecular Weight | 443.49 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | 1-(3,4-difluorophenyl)-3-[(1S,10S,12R)-4,5-dimethoxy-9-azatetracyclo[7.5.2.01,10.02,7]hexadeca-2,4,6-trien-12-yl]urea |
| SMILES | COc1cc2c(cc1OC)[C@@]13CC[C@@H](NC(=O)Nc4ccc(F)c(F)c4)C[C@@H]1N(CC3)C2 |
| InChI | InChI=1S/C24H27F2N3O3/c1-31-20-9-14-13-29-8-7-24(17(14)12-21(20)32-2)6-5-16(11-22(24)29)28-23(30)27-15-3-4-18(25)19(26)10-15/h3-4,9-10,12,16,22H,5-8,11,13H2,1-2H3,(H2,27,28,30)/t16-,22+,24+/m1/s1 |
| InChIKey | IAFOZSJSFVXWLZ-LZGLPUDESA-N |
| XLogP | 4.18 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.49 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |