C27H33ClO7 — CID 90862491
[3-acetyloxy-4-chloro-2-[7-[(2S)-5,5-dimethyl-4-oxooxolan-2-yl]-3-methylocta-2,6-dienyl]-6-formyl-5-methylphenyl] acetate (PubChem CID 90862491) has the molecular formula C27H33ClO7 and a molecular weight of 505.01 g/mol. Its IUPAC name is [3-acetyloxy-4-chloro-2-[7-[(2S)-5,5-dimethyl-4-oxooxolan-2-yl]-3-methylocta-2,6-dienyl]-6-formyl-5-methylphenyl] acetate.
| Compound Name | [3-acetyloxy-4-chloro-2-[7-[(2S)-5,5-dimethyl-4-oxooxolan-2-yl]-3-methylocta-2,6-dienyl]-6-formyl-5-methylphenyl] acetate |
|---|---|
| PubChem CID | 90862491 |
| Molecular Formula | C27H33ClO7 |
| Molecular Weight | 505.01 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | [3-acetyloxy-4-chloro-2-[7-[(2S)-5,5-dimethyl-4-oxooxolan-2-yl]-3-methylocta-2,6-dienyl]-6-formyl-5-methylphenyl] acetate |
| SMILES | CC(=O)Oc1c(Cl)c(C)c(C=O)c(OC(C)=O)c1CC=C(C)CCC=C(C)[C@@H]1CC(=O)C(C)(C)O1 |
| InChI | InChI=1S/C27H33ClO7/c1-15(9-8-10-16(2)22-13-23(32)27(6,7)35-22)11-12-20-25(33-18(4)30)21(14-29)17(3)24(28)26(20)34-19(5)31/h10-11,14,22H,8-9,12-13H2,1-7H3/t22-/m0/s1 |
| InChIKey | PDEBDPZZOCEREM-QFIPXVFZSA-N |
| XLogP | 5.66 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.01 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|