C27H35N7O6 — CID 90874743
(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]oxyamino]-3-[4-[3-[(2R)-2-aminopropyl]indole-1-carbonyl]oxyphenyl]propanoic acid (PubChem CID 90874743) has the molecular formula C27H35N7O6 and a molecular weight of 553.62 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]oxyamino]-3-[4-[3-[(2R)-2-aminopropyl]indole-1-carbonyl]oxyphenyl]propanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]oxyamino]-3-[4-[3-[(2R)-2-aminopropyl]indole-1-carbonyl]oxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 90874743 |
| Molecular Formula | C27H35N7O6 |
| Molecular Weight | 553.62 g/mol |
| Exact Mass | 553.26 |
| IUPAC Name | (2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]oxyamino]-3-[4-[3-[(2R)-2-aminopropyl]indole-1-carbonyl]oxyphenyl]propanoic acid |
| SMILES | C[C@@H](N)Cc1cn(C(=O)Oc2ccc(C[C@H](NOC(=O)[C@@H](N)CCCN=C(N)N)C(=O)O)cc2)c2ccccc12 |
| InChI | InChI=1S/C27H35N7O6/c1-16(28)13-18-15-34(23-7-3-2-5-20(18)23)27(38)39-19-10-8-17(9-11-19)14-22(24(35)36)33-40-25(37)21(29)6-4-12-32-26(30)31/h2-3,5,7-11,15-16,21-22,33H,4,6,12-14,28-29H2,1H3,(H,35,36)(H4,30,31,32)/t16-,21+,22+/m1/s1 |
| InChIKey | QECPTLYONKSGOW-XGRCMKMKSA-N |
| XLogP | 1.00 |
| TPSA | 223.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.62 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|