About 7-thia-6-azatricyclo[3.3.0.02,4]octa-1(8),5-diene
7-thia-6-azatricyclo[3.3.0.02,4]octa-1(8),5-diene (PubChem CID 90904453) has the molecular formula C6H5NS
and a molecular weight of 123.18 g/mol. Its IUPAC name is 7-thia-6-azatricyclo[3.3.0.02,4]octa-1(8),5-diene.
Analyze 7-thia-6-azatricyclo[3.3.0.02,4]octa-1(8),5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-thia-6-azatricyclo[3.3.0.02,4]octa-1(8),5-diene?
The IUPAC name of 7-thia-6-azatricyclo[3.3.0.02,4]octa-1(8),5-diene (CID 90904453) is 7-thia-6-azatricyclo[3.3.0.02,4]octa-1(8),5-diene.
What is the SMILES notation for 7-thia-6-azatricyclo[3.3.0.02,4]octa-1(8),5-diene?
The canonical SMILES for 7-thia-6-azatricyclo[3.3.0.02,4]octa-1(8),5-diene is c1snc2c1C1CC21.
What is the InChIKey of 7-thia-6-azatricyclo[3.3.0.02,4]octa-1(8),5-diene?
The InChIKey is STYUYUXQNKBRCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NS/c1-3-4(1)6-5(3)2-8-7-6/h2-4H,1H2.
What are the key properties of 7-thia-6-azatricyclo[3.3.0.02,4]octa-1(8),5-diene?
7-thia-6-azatricyclo[3.3.0.02,4]octa-1(8),5-diene has a molecular weight of 123.18 g/mol, XLogP of 1.73, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-thia-6-azatricyclo[3.3.0.02,4]octa-1(8),5-diene is sourced from PubChem (CID 90904453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).