C34H42N8O5 — CID 90979449
(2S,3S,4R,5R)-5-[2-[(2,2-diphenylethylamino)-(2-piperidin-1-ylethyl)carbamoyl]purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide (PubChem CID 90979449) has the molecular formula C34H42N8O5 and a molecular weight of 642.76 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-[2-[(2,2-diphenylethylamino)-(2-piperidin-1-ylethyl)carbamoyl]purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-5-[2-[(2,2-diphenylethylamino)-(2-piperidin-1-ylethyl)carbamoyl]purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide |
|---|---|
| PubChem CID | 90979449 |
| Molecular Formula | C34H42N8O5 |
| Molecular Weight | 642.76 g/mol |
| Exact Mass | 642.33 |
| IUPAC Name | (2S,3S,4R,5R)-5-[2-[(2,2-diphenylethylamino)-(2-piperidin-1-ylethyl)carbamoyl]purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide |
| SMILES | CCNC(=O)[C@H]1O[C@@H](n2cnc3cnc(C(=O)N(CCN4CCCCC4)NCC(c4ccccc4)c4ccccc4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C34H42N8O5/c1-2-35-32(45)29-27(43)28(44)34(47-29)41-22-37-26-21-36-30(39-31(26)41)33(46)42(19-18-40-16-10-5-11-17-40)38-20-25(23-12-6-3-7-13-23)24-14-8-4-9-15-24/h3-4,6-9,12-15,21-22,25,27-29,34,38,43-44H,2,5,10-11,16-20H2,1H3,(H,35,45)/t27-,28+,29-,34+/m0/s1 |
| InChIKey | JXMUDMUUPZIOKT-HKRZWTHNSA-N |
| XLogP | 1.85 |
| TPSA | 157.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.76 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|