C35H54O7Si2 — CID 90996921
ethenyl-[3-[2-[4-[2-[4-[2-[2-[3-[ethenyl(dimethyl)silyl]propoxy]ethoxyperoxy]ethenoxy]phenyl]propan-2-yl]phenoxy]ethoxy]propyl]-dimethylsilane (PubChem CID 90996921) has the molecular formula C35H54O7Si2 and a molecular weight of 642.98 g/mol. Its IUPAC name is ethenyl-[3-[2-[4-[2-[4-[2-[2-[3-[ethenyl(dimethyl)silyl]propoxy]ethoxyperoxy]ethenoxy]phenyl]propan-2-yl]phenoxy]ethoxy]propyl]-dimethylsilane.
| Compound Name | ethenyl-[3-[2-[4-[2-[4-[2-[2-[3-[ethenyl(dimethyl)silyl]propoxy]ethoxyperoxy]ethenoxy]phenyl]propan-2-yl]phenoxy]ethoxy]propyl]-dimethylsilane |
|---|---|
| PubChem CID | 90996921 |
| Molecular Formula | C35H54O7Si2 |
| Molecular Weight | 642.98 g/mol |
| Exact Mass | 642.34 |
| IUPAC Name | ethenyl-[3-[2-[4-[2-[4-[2-[2-[3-[ethenyl(dimethyl)silyl]propoxy]ethoxyperoxy]ethenoxy]phenyl]propan-2-yl]phenoxy]ethoxy]propyl]-dimethylsilane |
| SMILES | C=C[Si](C)(C)CCCOCCOOOC=COc1ccc(C(C)(C)c2ccc(OCCOCCC[Si](C)(C)C=C)cc2)cc1 |
| InChI | InChI=1S/C35H54O7Si2/c1-9-43(5,6)29-11-21-36-23-25-38-33-17-13-31(14-18-33)35(3,4)32-15-19-34(20-16-32)39-26-28-41-42-40-27-24-37-22-12-30-44(7,8)10-2/h9-10,13-20,26,28H,1-2,11-12,21-25,27,29-30H2,3-8H3 |
| InChIKey | LXYHFJCQNDOALW-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.98 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|