C24H30F2INO4Si — CID 91008546
ethyl 2-[3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-(2,3-difluoro-5-iodobenzoyl)pyrrol-2-yl]prop-2-enoate (PubChem CID 91008546) has the molecular formula C24H30F2INO4Si and a molecular weight of 589.49 g/mol. Its IUPAC name is ethyl 2-[3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-(2,3-difluoro-5-iodobenzoyl)pyrrol-2-yl]prop-2-enoate.
| Compound Name | ethyl 2-[3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-(2,3-difluoro-5-iodobenzoyl)pyrrol-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 91008546 |
| Molecular Formula | C24H30F2INO4Si |
| Molecular Weight | 589.49 g/mol |
| Exact Mass | 589.10 |
| IUPAC Name | ethyl 2-[3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-(2,3-difluoro-5-iodobenzoyl)pyrrol-2-yl]prop-2-enoate |
| SMILES | C=C(C(=O)OCC)C1(C(=O)c2cc(I)cc(F)c2F)N=CC=C1CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H30F2INO4Si/c1-8-31-22(30)15(2)24(21(29)18-13-17(27)14-19(25)20(18)26)16(9-11-28-24)10-12-32-33(6,7)23(3,4)5/h9,11,13-14H,2,8,10,12H2,1,3-7H3 |
| InChIKey | RPKRSEKKIHVZGR-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.49 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|