C21H15FN6O5S — CID 91016825
4-[[3-fluoro-4-[(6-nitro-1,3-benzothiazol-2-yl)carbamoylamino]phenoxy]methyl]pyridine-2-carboxamide (PubChem CID 91016825) has the molecular formula C21H15FN6O5S and a molecular weight of 482.45 g/mol. Its IUPAC name is 4-[[3-fluoro-4-[(6-nitro-1,3-benzothiazol-2-yl)carbamoylamino]phenoxy]methyl]pyridine-2-carboxamide.
| Compound Name | 4-[[3-fluoro-4-[(6-nitro-1,3-benzothiazol-2-yl)carbamoylamino]phenoxy]methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 91016825 |
| Molecular Formula | C21H15FN6O5S |
| Molecular Weight | 482.45 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | 4-[[3-fluoro-4-[(6-nitro-1,3-benzothiazol-2-yl)carbamoylamino]phenoxy]methyl]pyridine-2-carboxamide |
| SMILES | NC(=O)c1cc(COc2ccc(NC(=O)Nc3nc4ccc([N+](=O)[O-])cc4s3)c(F)c2)ccn1 |
| InChI | InChI=1S/C21H15FN6O5S/c22-14-9-13(33-10-11-5-6-24-17(7-11)19(23)29)2-4-15(14)25-20(30)27-21-26-16-3-1-12(28(31)32)8-18(16)34-21/h1-9H,10H2,(H2,23,29)(H2,25,26,27,30) |
| InChIKey | IUKJWUPGMMMEQP-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 162.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.45 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|