C22H16Cl2F5N3O3S — CID 91259185
5-[[[4-[2-(2,3-dichlorophenyl)ethyl-sulfinoamino]-2,3-difluorobenzoyl]amino]methyl]-2-(trifluoromethyl)pyridine (PubChem CID 91259185) has the molecular formula C22H16Cl2F5N3O3S and a molecular weight of 568.35 g/mol. Its IUPAC name is 5-[[[4-[2-(2,3-dichlorophenyl)ethyl-sulfinoamino]-2,3-difluorobenzoyl]amino]methyl]-2-(trifluoromethyl)pyridine.
| Compound Name | 5-[[[4-[2-(2,3-dichlorophenyl)ethyl-sulfinoamino]-2,3-difluorobenzoyl]amino]methyl]-2-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 91259185 |
| Molecular Formula | C22H16Cl2F5N3O3S |
| Molecular Weight | 568.35 g/mol |
| Exact Mass | 567.02 |
| IUPAC Name | 5-[[[4-[2-(2,3-dichlorophenyl)ethyl-sulfinoamino]-2,3-difluorobenzoyl]amino]methyl]-2-(trifluoromethyl)pyridine |
| SMILES | O=C(NCc1ccc(C(F)(F)F)nc1)c1ccc(N(CCc2cccc(Cl)c2Cl)S(=O)O)c(F)c1F |
| InChI | InChI=1S/C22H16Cl2F5N3O3S/c23-15-3-1-2-13(18(15)24)8-9-32(36(34)35)16-6-5-14(19(25)20(16)26)21(33)31-11-12-4-7-17(30-10-12)22(27,28)29/h1-7,10H,8-9,11H2,(H,31,33)(H,34,35) |
| InChIKey | SVABNBKZDVOLNP-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.35 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|