C18H19BrN2 — CID 91281482
6'-bromo-4-methylspiro[3,5,7,8-tetrahydro-2H-quinoline-6,2'-3H-indene]-1'-imine (PubChem CID 91281482) has the molecular formula C18H19BrN2 and a molecular weight of 343.27 g/mol. Its IUPAC name is 6'-bromo-4-methylspiro[3,5,7,8-tetrahydro-2H-quinoline-6,2'-3H-indene]-1'-imine.
| Compound Name | 6'-bromo-4-methylspiro[3,5,7,8-tetrahydro-2H-quinoline-6,2'-3H-indene]-1'-imine |
|---|---|
| PubChem CID | 91281482 |
| Molecular Formula | C18H19BrN2 |
| Molecular Weight | 343.27 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 6'-bromo-4-methylspiro[3,5,7,8-tetrahydro-2H-quinoline-6,2'-3H-indene]-1'-imine |
| SMILES | [H]/N=C1\c2cc(Br)ccc2CC12CCC1=NCCC(C)=C1C2 |
| InChI | InChI=1S/C18H19BrN2/c1-11-5-7-21-16-4-6-18(10-15(11)16)9-12-2-3-13(19)8-14(12)17(18)20/h2-3,8,20H,4-7,9-10H2,1H3/b20-17+ |
| InChIKey | DJQMCIIIIPEVPN-LVZFUZTISA-N |
| XLogP | 4.70 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.27 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|