C22H25BrN6S — CID 91330124
N-(2-bromoethyl)-4-[[4-[[(3,4-dimethyl-1,3-thiazol-2-ylidene)hydrazinylidene]methyl]phenyl]diazenyl]-N-ethylaniline (PubChem CID 91330124) has the molecular formula C22H25BrN6S and a molecular weight of 485.46 g/mol. Its IUPAC name is N-(2-bromoethyl)-4-[[4-[[(3,4-dimethyl-1,3-thiazol-2-ylidene)hydrazinylidene]methyl]phenyl]diazenyl]-N-ethylaniline.
| Compound Name | N-(2-bromoethyl)-4-[[4-[[(3,4-dimethyl-1,3-thiazol-2-ylidene)hydrazinylidene]methyl]phenyl]diazenyl]-N-ethylaniline |
|---|---|
| PubChem CID | 91330124 |
| Molecular Formula | C22H25BrN6S |
| Molecular Weight | 485.46 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | N-(2-bromoethyl)-4-[[4-[[(3,4-dimethyl-1,3-thiazol-2-ylidene)hydrazinylidene]methyl]phenyl]diazenyl]-N-ethylaniline |
| SMILES | CCN(CCBr)c1ccc(/N=N/c2ccc(C=NN=c3scc(C)n3C)cc2)cc1 |
| InChI | InChI=1S/C22H25BrN6S/c1-4-29(14-13-23)21-11-9-20(10-12-21)26-25-19-7-5-18(6-8-19)15-24-27-22-28(3)17(2)16-30-22/h5-12,15-16H,4,13-14H2,1-3H3/b24-15?,26-25+,27-22? |
| InChIKey | VJMTYGRZNFPKGQ-YPYBWXOVSA-N |
| XLogP | 5.97 |
| TPSA | 57.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.46 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|