C20H34O — CID 91334483
3-(2-ethylidenehexa-3,5-dienoxy)-7,7,8-trimethylnon-4-ene (PubChem CID 91334483) has the molecular formula C20H34O and a molecular weight of 290.49 g/mol. Its IUPAC name is 3-(2-ethylidenehexa-3,5-dienoxy)-7,7,8-trimethylnon-4-ene.
| Compound Name | 3-(2-ethylidenehexa-3,5-dienoxy)-7,7,8-trimethylnon-4-ene |
|---|---|
| PubChem CID | 91334483 |
| Molecular Formula | C20H34O |
| Molecular Weight | 290.49 g/mol |
| Exact Mass | 290.26 |
| IUPAC Name | 3-(2-ethylidenehexa-3,5-dienoxy)-7,7,8-trimethylnon-4-ene |
| SMILES | C=CC=CC(=CC)COC(C=CCC(C)(C)C(C)C)CC |
| InChI | InChI=1S/C20H34O/c1-8-11-13-18(9-2)16-21-19(10-3)14-12-15-20(6,7)17(4)5/h8-9,11-14,17,19H,1,10,15-16H2,2-7H3 |
| InChIKey | VNZGGLKMDXBEDF-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.49 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|