C31H47NO5Si — CID 91380656
but-3-enyl (2S)-2-[[7-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]-6-methylhepta-2,4,6-trienoyl]amino]-3,3-dimethylbutanoate (PubChem CID 91380656) has the molecular formula C31H47NO5Si and a molecular weight of 541.81 g/mol. Its IUPAC name is but-3-enyl (2S)-2-[[7-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]-6-methylhepta-2,4,6-trienoyl]amino]-3,3-dimethylbutanoate.
| Compound Name | but-3-enyl (2S)-2-[[7-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]-6-methylhepta-2,4,6-trienoyl]amino]-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 91380656 |
| Molecular Formula | C31H47NO5Si |
| Molecular Weight | 541.81 g/mol |
| Exact Mass | 541.32 |
| IUPAC Name | but-3-enyl (2S)-2-[[7-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]-6-methylhepta-2,4,6-trienoyl]amino]-3,3-dimethylbutanoate |
| SMILES | C=CCCOC(=O)[C@@H](NC(=O)C=CC=CC(C)=Cc1ccc(O[Si](C)(C)C(C)(C)C)c(OC)c1)C(C)(C)C |
| InChI | InChI=1S/C31H47NO5Si/c1-12-13-20-36-29(34)28(30(3,4)5)32-27(33)17-15-14-16-23(2)21-24-18-19-25(26(22-24)35-9)37-38(10,11)31(6,7)8/h12,14-19,21-22,28H,1,13,20H2,2-11H3,(H,32,33)/t28-/m1/s1 |
| InChIKey | ZGGVBIMALFGUEL-MUUNZHRXSA-N |
| XLogP | 7.25 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.81 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|