C26H26F5N3O2+2 — CID 91393892
6-[6,6-diethyl-9,11-difluoro-2-methyl-10-(trifluoromethyl)-7H-benzo[a]quinolizin-5-ium-7-yl]-2-methyl-5,6-dihydroimidazo[5,1-c][1,4]oxazin-2-ium-8-one (PubChem CID 91393892) has the molecular formula C26H26F5N3O2+2 and a molecular weight of 507.50 g/mol. Its IUPAC name is 6-[6,6-diethyl-9,11-difluoro-2-methyl-10-(trifluoromethyl)-7H-benzo[a]quinolizin-5-ium-7-yl]-2-methyl-5,6-dihydroimidazo[5,1-c][1,4]oxazin-2-ium-8-one.
| Compound Name | 6-[6,6-diethyl-9,11-difluoro-2-methyl-10-(trifluoromethyl)-7H-benzo[a]quinolizin-5-ium-7-yl]-2-methyl-5,6-dihydroimidazo[5,1-c][1,4]oxazin-2-ium-8-one |
|---|---|
| PubChem CID | 91393892 |
| Molecular Formula | C26H26F5N3O2+2 |
| Molecular Weight | 507.50 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | 6-[6,6-diethyl-9,11-difluoro-2-methyl-10-(trifluoromethyl)-7H-benzo[a]quinolizin-5-ium-7-yl]-2-methyl-5,6-dihydroimidazo[5,1-c][1,4]oxazin-2-ium-8-one |
| SMILES | CCC1(CC)C(C2Cn3c[n+](C)cc3C(=O)O2)c2cc(F)c(C(F)(F)F)c(F)c2-c2cc(C)cc[n+]21 |
| InChI | InChI=1S/C26H26F5N3O2/c1-5-25(6-2)21(19-12-33-13-32(4)11-18(33)24(35)36-19)15-10-16(27)22(26(29,30)31)23(28)20(15)17-9-14(3)7-8-34(17)25/h7-11,13,19,21H,5-6,12H2,1-4H3/q+2 |
| InChIKey | OYLZMPUCBIKVPJ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 38.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.50 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|