C22H23FN4O3S — CID 91400489
(6S)-3-(7-amino-1-methylidene-1-oxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-6-ethyl-1-[(4-fluorophenyl)methyl]piperidine-2,4-dione (PubChem CID 91400489) has the molecular formula C22H23FN4O3S and a molecular weight of 442.52 g/mol. Its IUPAC name is (6S)-3-(7-amino-1-methylidene-1-oxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-6-ethyl-1-[(4-fluorophenyl)methyl]piperidine-2,4-dione.
| Compound Name | (6S)-3-(7-amino-1-methylidene-1-oxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-6-ethyl-1-[(4-fluorophenyl)methyl]piperidine-2,4-dione |
|---|---|
| PubChem CID | 91400489 |
| Molecular Formula | C22H23FN4O3S |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | (6S)-3-(7-amino-1-methylidene-1-oxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-6-ethyl-1-[(4-fluorophenyl)methyl]piperidine-2,4-dione |
| SMILES | C=S1(=O)N=C(C2C(=O)C[C@H](CC)N(Cc3ccc(F)cc3)C2=O)Nc2ccc(N)cc21 |
| InChI | InChI=1S/C22H23FN4O3S/c1-3-16-11-18(28)20(22(29)27(16)12-13-4-6-14(23)7-5-13)21-25-17-9-8-15(24)10-19(17)31(2,30)26-21/h4-10,16,20H,2-3,11-12,24H2,1H3,(H,25,26,30)/t16-,20?,31?/m0/s1 |
| InChIKey | NFRSPHQYYKRQSA-QICXZRFMSA-N |
| XLogP | 2.62 |
| TPSA | 104.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|