C24H20N6 — CID 91438525
3-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)-2-propan-2-yl-1H-indol-5-amine (PubChem CID 91438525) has the molecular formula C24H20N6 and a molecular weight of 392.47 g/mol. Its IUPAC name is 3-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)-2-propan-2-yl-1H-indol-5-amine.
| Compound Name | 3-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)-2-propan-2-yl-1H-indol-5-amine |
|---|---|
| PubChem CID | 91438525 |
| Molecular Formula | C24H20N6 |
| Molecular Weight | 392.47 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 3-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)-2-propan-2-yl-1H-indol-5-amine |
| SMILES | CC(C)c1[nH]c2ccc(N)cc2c1-c1nc2c3cccnc3c3ncccc3c2[nH]1 |
| InChI | InChI=1S/C24H20N6/c1-12(2)19-18(16-11-13(25)7-8-17(16)28-19)24-29-22-14-5-3-9-26-20(14)21-15(23(22)30-24)6-4-10-27-21/h3-12,28H,25H2,1-2H3,(H,29,30) |
| InChIKey | FRTDEUWNJONOHO-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.47 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|