C20H31NO4 — CID 91743505
2,2,4-trimethyl-5-nitro-7-(2,4,4-trimethylpentan-2-yl)-3,4-dihydrochromen-6-ol (PubChem CID 91743505) has the molecular formula C20H31NO4 and a molecular weight of 349.47 g/mol. Its IUPAC name is 2,2,4-trimethyl-5-nitro-7-(2,4,4-trimethylpentan-2-yl)-3,4-dihydrochromen-6-ol.
| Compound Name | 2,2,4-trimethyl-5-nitro-7-(2,4,4-trimethylpentan-2-yl)-3,4-dihydrochromen-6-ol |
|---|---|
| PubChem CID | 91743505 |
| Molecular Formula | C20H31NO4 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | 2,2,4-trimethyl-5-nitro-7-(2,4,4-trimethylpentan-2-yl)-3,4-dihydrochromen-6-ol |
| SMILES | CC1CC(C)(C)Oc2cc(C(C)(C)CC(C)(C)C)c(O)c([N+](=O)[O-])c21 |
| InChI | InChI=1S/C20H31NO4/c1-12-10-20(7,8)25-14-9-13(19(5,6)11-18(2,3)4)17(22)16(15(12)14)21(23)24/h9,12,22H,10-11H2,1-8H3 |
| InChIKey | PHJMZHCDGGMWFX-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|