C27H27N7O2 — CID 95149481
N'-[(2S)-2-phenyl-2-pyrrolidin-1-ylacetyl]-4-[(5-phenyltetrazol-2-yl)methyl]benzohydrazide (PubChem CID 95149481) has the molecular formula C27H27N7O2 and a molecular weight of 481.56 g/mol. Its IUPAC name is N'-[(2S)-2-phenyl-2-pyrrolidin-1-ylacetyl]-4-[(5-phenyltetrazol-2-yl)methyl]benzohydrazide.
| Compound Name | N'-[(2S)-2-phenyl-2-pyrrolidin-1-ylacetyl]-4-[(5-phenyltetrazol-2-yl)methyl]benzohydrazide |
|---|---|
| PubChem CID | 95149481 |
| Molecular Formula | C27H27N7O2 |
| Molecular Weight | 481.56 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | N'-[(2S)-2-phenyl-2-pyrrolidin-1-ylacetyl]-4-[(5-phenyltetrazol-2-yl)methyl]benzohydrazide |
| SMILES | O=C(NNC(=O)[C@H](c1ccccc1)N1CCCC1)c1ccc(Cn2nnc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C27H27N7O2/c35-26(29-30-27(36)24(33-17-7-8-18-33)21-9-3-1-4-10-21)23-15-13-20(14-16-23)19-34-31-25(28-32-34)22-11-5-2-6-12-22/h1-6,9-16,24H,7-8,17-19H2,(H,29,35)(H,30,36)/t24-/m0/s1 |
| InChIKey | CKZHXGJEOBPFFG-DEOSSOPVSA-N |
| XLogP | 2.99 |
| TPSA | 105.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.56 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|