C13H16ClN3O2S2 — CID 95975070
2-chloro-4-[[(2S)-1,4-dithian-2-yl]methylcarbamoylamino]benzamide (PubChem CID 95975070) has the molecular formula C13H16ClN3O2S2 and a molecular weight of 345.88 g/mol. Its IUPAC name is 2-chloro-4-[[(2S)-1,4-dithian-2-yl]methylcarbamoylamino]benzamide.
| Compound Name | 2-chloro-4-[[(2S)-1,4-dithian-2-yl]methylcarbamoylamino]benzamide |
|---|---|
| PubChem CID | 95975070 |
| Molecular Formula | C13H16ClN3O2S2 |
| Molecular Weight | 345.88 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 2-chloro-4-[[(2S)-1,4-dithian-2-yl]methylcarbamoylamino]benzamide |
| SMILES | NC(=O)c1ccc(NC(=O)NC[C@H]2CSCCS2)cc1Cl |
| InChI | InChI=1S/C13H16ClN3O2S2/c14-11-5-8(1-2-10(11)12(15)18)17-13(19)16-6-9-7-20-3-4-21-9/h1-2,5,9H,3-4,6-7H2,(H2,15,18)(H2,16,17,19)/t9-/m0/s1 |
| InChIKey | CFRDYTQFIGJPAW-VIFPVBQESA-N |
| XLogP | 2.41 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.88 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |