C17H18O3S2 — CID 98506814
[(1S,2R,3R,5S,6R,7R,9S,10R,11R)-8-thiapentacyclo[5.4.0.02,6.03,10.05,9]undecan-11-yl] 4-methylbenzenesulfonate (PubChem CID 98506814) has the molecular formula C17H18O3S2 and a molecular weight of 334.46 g/mol. Its IUPAC name is [(1S,2R,3R,5S,6R,7R,9S,10R,11R)-8-thiapentacyclo[5.4.0.02,6.03,10.05,9]undecan-11-yl] 4-methylbenzenesulfonate.
| Compound Name | [(1S,2R,3R,5S,6R,7R,9S,10R,11R)-8-thiapentacyclo[5.4.0.02,6.03,10.05,9]undecan-11-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 98506814 |
| Molecular Formula | C17H18O3S2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | [(1S,2R,3R,5S,6R,7R,9S,10R,11R)-8-thiapentacyclo[5.4.0.02,6.03,10.05,9]undecan-11-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H]2[C@H]3[C@@H]4C[C@@H]5[C@@H]3S[C@@H]3[C@@H]5[C@@H]4[C@@H]23)cc1 |
| InChI | InChI=1S/C17H18O3S2/c1-7-2-4-8(5-3-7)22(18,19)20-15-13-9-6-10-12-11(9)14(15)17(12)21-16(10)13/h2-5,9-17H,6H2,1H3/t9-,10+,11-,12+,13-,14+,15-,16+,17-/m1/s1 |
| InChIKey | IJOQHVCJLFLQPZ-LSXUETHQSA-N |
| XLogP | 2.69 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|