C21H30O6S — CID 10024562
methyl 2-[(2R,3R,4S)-4-(benzenesulfonyl)-2-hexyl-3,4-dimethyl-5-oxooxolan-3-yl]acetate (PubChem CID 10024562) has the molecular formula C21H30O6S and a molecular weight of 410.53 g/mol. Its IUPAC name is methyl 2-[(2R,3R,4S)-4-(benzenesulfonyl)-2-hexyl-3,4-dimethyl-5-oxooxolan-3-yl]acetate.
| Compound Name | methyl 2-[(2R,3R,4S)-4-(benzenesulfonyl)-2-hexyl-3,4-dimethyl-5-oxooxolan-3-yl]acetate |
|---|---|
| PubChem CID | 10024562 |
| Molecular Formula | C21H30O6S |
| Molecular Weight | 410.53 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | methyl 2-[(2R,3R,4S)-4-(benzenesulfonyl)-2-hexyl-3,4-dimethyl-5-oxooxolan-3-yl]acetate |
| SMILES | CCCCCC[C@H]1OC(=O)[C@@](C)(S(=O)(=O)c2ccccc2)[C@]1(C)CC(=O)OC |
| InChI | InChI=1S/C21H30O6S/c1-5-6-7-11-14-17-20(2,15-18(22)26-4)21(3,19(23)27-17)28(24,25)16-12-9-8-10-13-16/h8-10,12-13,17H,5-7,11,14-15H2,1-4H3/t17-,20-,21-/m1/s1 |
| InChIKey | XJEXSAQENVDENZ-DUXKGJEZSA-N |
| XLogP | 3.68 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.53 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|