C40H39N3O3 — CID 101013913
10,10-dimethyl-3-phenyl-4-[(5R)-3-(1,1,2-triphenylethyl)-4,5-dihydro-1,2-oxazole-5-carbonyl]-3,4-diazatricyclo[5.2.1.01,5]decan-2-one (PubChem CID 101013913) has the molecular formula C40H39N3O3 and a molecular weight of 609.77 g/mol. Its IUPAC name is 10,10-dimethyl-3-phenyl-4-[(5R)-3-(1,1,2-triphenylethyl)-4,5-dihydro-1,2-oxazole-5-carbonyl]-3,4-diazatricyclo[5.2.1.01,5]decan-2-one.
| Compound Name | 10,10-dimethyl-3-phenyl-4-[(5R)-3-(1,1,2-triphenylethyl)-4,5-dihydro-1,2-oxazole-5-carbonyl]-3,4-diazatricyclo[5.2.1.01,5]decan-2-one |
|---|---|
| PubChem CID | 101013913 |
| Molecular Formula | C40H39N3O3 |
| Molecular Weight | 609.77 g/mol |
| Exact Mass | 609.30 |
| IUPAC Name | 10,10-dimethyl-3-phenyl-4-[(5R)-3-(1,1,2-triphenylethyl)-4,5-dihydro-1,2-oxazole-5-carbonyl]-3,4-diazatricyclo[5.2.1.01,5]decan-2-one |
| SMILES | CC1(C)C2CCC13C(=O)N(c1ccccc1)N(C(=O)[C@H]1CC(C(Cc4ccccc4)(c4ccccc4)c4ccccc4)=NO1)C3C2 |
| InChI | InChI=1S/C40H39N3O3/c1-38(2)31-23-24-40(38)35(25-31)43(42(37(40)45)32-21-13-6-14-22-32)36(44)33-26-34(41-46-33)39(29-17-9-4-10-18-29,30-19-11-5-12-20-30)27-28-15-7-3-8-16-28/h3-22,31,33,35H,23-27H2,1-2H3/t31?,33-,35?,40?/m1/s1 |
| InChIKey | GTJFVLXEYROQLH-KKLGGRQCSA-N |
| XLogP | 7.35 |
| TPSA | 62.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.77 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |