C38H60O5Si2 — CID 101042343
methyl (E,5S)-5-[(4S,5R,6R)-2,2-ditert-butyl-6-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-5-methyl-1,3,2-dioxasilinan-4-yl]hex-3-enoate (PubChem CID 101042343) has the molecular formula C38H60O5Si2 and a molecular weight of 653.07 g/mol. Its IUPAC name is methyl (E,5S)-5-[(4S,5R,6R)-2,2-ditert-butyl-6-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-5-methyl-1,3,2-dioxasilinan-4-yl]hex-3-enoate.
| Compound Name | methyl (E,5S)-5-[(4S,5R,6R)-2,2-ditert-butyl-6-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-5-methyl-1,3,2-dioxasilinan-4-yl]hex-3-enoate |
|---|---|
| PubChem CID | 101042343 |
| Molecular Formula | C38H60O5Si2 |
| Molecular Weight | 653.07 g/mol |
| Exact Mass | 652.40 |
| IUPAC Name | methyl (E,5S)-5-[(4S,5R,6R)-2,2-ditert-butyl-6-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-5-methyl-1,3,2-dioxasilinan-4-yl]hex-3-enoate |
| SMILES | COC(=O)C/C=C/[C@H](C)[C@@H]1O[Si](C(C)(C)C)(C(C)(C)C)O[C@H]([C@H](C)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H]1C |
| InChI | InChI=1S/C38H60O5Si2/c1-28(21-20-26-33(39)40-13)34-30(3)35(43-45(42-34,37(7,8)9)38(10,11)12)29(2)27-41-44(36(4,5)6,31-22-16-14-17-23-31)32-24-18-15-19-25-32/h14-25,28-30,34-35H,26-27H2,1-13H3/b21-20+/t28-,29+,30+,34-,35+/m0/s1 |
| InChIKey | MAEUDJDPXKPBDO-OVQAFDNVSA-N |
| XLogP | 8.42 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.07 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|