C44H42N4O3 — CID 101053700
1-hydroxy-4-[2-(5,5,10,10,15,15,20,20-octamethyl-21,22,23,24-tetrahydroporphyrin-2-yl)ethynyl]anthracene-9,10-dione (PubChem CID 101053700) has the molecular formula C44H42N4O3 and a molecular weight of 674.85 g/mol. Its IUPAC name is 1-hydroxy-4-[2-(5,5,10,10,15,15,20,20-octamethyl-21,22,23,24-tetrahydroporphyrin-2-yl)ethynyl]anthracene-9,10-dione.
| Compound Name | 1-hydroxy-4-[2-(5,5,10,10,15,15,20,20-octamethyl-21,22,23,24-tetrahydroporphyrin-2-yl)ethynyl]anthracene-9,10-dione |
|---|---|
| PubChem CID | 101053700 |
| Molecular Formula | C44H42N4O3 |
| Molecular Weight | 674.85 g/mol |
| Exact Mass | 674.33 |
| IUPAC Name | 1-hydroxy-4-[2-(5,5,10,10,15,15,20,20-octamethyl-21,22,23,24-tetrahydroporphyrin-2-yl)ethynyl]anthracene-9,10-dione |
| SMILES | CC1(C)c2ccc([nH]2)C(C)(C)c2ccc([nH]2)C(C)(C)c2[nH]c(cc2C#Cc2ccc(O)c3c2C(=O)c2ccccc2C3=O)C(C)(C)c2ccc1[nH]2 |
| InChI | InChI=1S/C44H42N4O3/c1-41(2)29-17-18-30(45-29)42(3,4)32-21-22-34(47-32)44(7,8)40-25(23-35(48-40)43(5,6)33-20-19-31(41)46-33)14-13-24-15-16-28(49)37-36(24)38(50)26-11-9-10-12-27(26)39(37)51/h9-12,15-23,45-49H,1-8H3 |
| InChIKey | QOOALRVQAPPNDG-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 117.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.85 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|