C38H57NO7S — CID 101110323
propan-2-yl (3S,5R,6S,7S,8S,12Z,15S,16E)-15-acetyloxy-3,5-dihydroxy-4,4,6,8,16-pentamethyl-17-(2-methyl-1,3-thiazol-4-yl)-7-phenylmethoxyheptadeca-12,16-dienoate (PubChem CID 101110323) has the molecular formula C38H57NO7S and a molecular weight of 671.94 g/mol. Its IUPAC name is propan-2-yl (3S,5R,6S,7S,8S,12Z,15S,16E)-15-acetyloxy-3,5-dihydroxy-4,4,6,8,16-pentamethyl-17-(2-methyl-1,3-thiazol-4-yl)-7-phenylmethoxyheptadeca-12,16-dienoate.
| Compound Name | propan-2-yl (3S,5R,6S,7S,8S,12Z,15S,16E)-15-acetyloxy-3,5-dihydroxy-4,4,6,8,16-pentamethyl-17-(2-methyl-1,3-thiazol-4-yl)-7-phenylmethoxyheptadeca-12,16-dienoate |
|---|---|
| PubChem CID | 101110323 |
| Molecular Formula | C38H57NO7S |
| Molecular Weight | 671.94 g/mol |
| Exact Mass | 671.39 |
| IUPAC Name | propan-2-yl (3S,5R,6S,7S,8S,12Z,15S,16E)-15-acetyloxy-3,5-dihydroxy-4,4,6,8,16-pentamethyl-17-(2-methyl-1,3-thiazol-4-yl)-7-phenylmethoxyheptadeca-12,16-dienoate |
| SMILES | CC(=O)O[C@@H](C/C=C\CCC[C@H](C)[C@H](OCc1ccccc1)[C@@H](C)[C@@H](O)C(C)(C)[C@@H](O)CC(=O)OC(C)C)/C(C)=C/c1csc(C)n1 |
| InChI | InChI=1S/C38H57NO7S/c1-25(2)45-35(42)22-34(41)38(8,9)37(43)28(5)36(44-23-31-18-14-12-15-19-31)26(3)17-13-10-11-16-20-33(46-30(7)40)27(4)21-32-24-47-29(6)39-32/h11-12,14-16,18-19,21,24-26,28,33-34,36-37,41,43H,10,13,17,20,22-23H2,1-9H3/b16-11-,27-21+/t26-,28+,33-,34-,36-,37+/m0/s1 |
| InChIKey | JPTOVEBEFIZCOS-QWTCLHRXSA-N |
| XLogP | 7.85 |
| TPSA | 115.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.94 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|