C32H42O2S2Si — CID 101208323
(2S)-4-[tert-butyl(diphenyl)silyl]oxy-1-[2-(2-phenylethyl)-1,3-dithian-2-yl]butan-2-ol (PubChem CID 101208323) has the molecular formula C32H42O2S2Si and a molecular weight of 550.91 g/mol. Its IUPAC name is (2S)-4-[tert-butyl(diphenyl)silyl]oxy-1-[2-(2-phenylethyl)-1,3-dithian-2-yl]butan-2-ol.
| Compound Name | (2S)-4-[tert-butyl(diphenyl)silyl]oxy-1-[2-(2-phenylethyl)-1,3-dithian-2-yl]butan-2-ol |
|---|---|
| PubChem CID | 101208323 |
| Molecular Formula | C32H42O2S2Si |
| Molecular Weight | 550.91 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | (2S)-4-[tert-butyl(diphenyl)silyl]oxy-1-[2-(2-phenylethyl)-1,3-dithian-2-yl]butan-2-ol |
| SMILES | CC(C)(C)[Si](OCC[C@H](O)CC1(CCc2ccccc2)SCCCS1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H42O2S2Si/c1-31(2,3)37(29-16-9-5-10-17-29,30-18-11-6-12-19-30)34-23-21-28(33)26-32(35-24-13-25-36-32)22-20-27-14-7-4-8-15-27/h4-12,14-19,28,33H,13,20-26H2,1-3H3/t28-/m0/s1 |
| InChIKey | HKHQKHGQWZDGAK-NDEPHWFRSA-N |
| XLogP | 6.90 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.91 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|