C27H34N2OSi — CID 101270620
2-[4-[(E)-1-[dimethyl(pyridin-2-yl)silyl]-2-phenylbut-1-enyl]phenoxy]-N,N-dimethylethanamine (PubChem CID 101270620) has the molecular formula C27H34N2OSi and a molecular weight of 430.67 g/mol. Its IUPAC name is 2-[4-[(E)-1-[dimethyl(pyridin-2-yl)silyl]-2-phenylbut-1-enyl]phenoxy]-N,N-dimethylethanamine.
| Compound Name | 2-[4-[(E)-1-[dimethyl(pyridin-2-yl)silyl]-2-phenylbut-1-enyl]phenoxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 101270620 |
| Molecular Formula | C27H34N2OSi |
| Molecular Weight | 430.67 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | 2-[4-[(E)-1-[dimethyl(pyridin-2-yl)silyl]-2-phenylbut-1-enyl]phenoxy]-N,N-dimethylethanamine |
| SMILES | CC/C(=C(/c1ccc(OCCN(C)C)cc1)[Si](C)(C)c1ccccn1)c1ccccc1 |
| InChI | InChI=1S/C27H34N2OSi/c1-6-25(22-12-8-7-9-13-22)27(31(4,5)26-14-10-11-19-28-26)23-15-17-24(18-16-23)30-21-20-29(2)3/h7-19H,6,20-21H2,1-5H3/b27-25+ |
| InChIKey | SMEWZOYRQXELQK-IMVLJIQESA-N |
| XLogP | 5.50 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.67 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|