C33H57BO5Si — CID 101412943
tert-butyl-[(2S,3S)-5-dicyclohexylboranyloxy-3-methoxy-1-[(4-methoxyphenyl)methoxy]hex-5-en-2-yl]oxy-dimethylsilane (PubChem CID 101412943) has the molecular formula C33H57BO5Si and a molecular weight of 572.71 g/mol. Its IUPAC name is tert-butyl-[(2S,3S)-5-dicyclohexylboranyloxy-3-methoxy-1-[(4-methoxyphenyl)methoxy]hex-5-en-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2S,3S)-5-dicyclohexylboranyloxy-3-methoxy-1-[(4-methoxyphenyl)methoxy]hex-5-en-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 101412943 |
| Molecular Formula | C33H57BO5Si |
| Molecular Weight | 572.71 g/mol |
| Exact Mass | 572.41 |
| IUPAC Name | tert-butyl-[(2S,3S)-5-dicyclohexylboranyloxy-3-methoxy-1-[(4-methoxyphenyl)methoxy]hex-5-en-2-yl]oxy-dimethylsilane |
| SMILES | C=C(C[C@H](OC)[C@H](COCc1ccc(OC)cc1)O[Si](C)(C)C(C)(C)C)OB(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C33H57BO5Si/c1-26(38-34(28-15-11-9-12-16-28)29-17-13-10-14-18-29)23-31(36-6)32(39-40(7,8)33(2,3)4)25-37-24-27-19-21-30(35-5)22-20-27/h19-22,28-29,31-32H,1,9-18,23-25H2,2-8H3/t31-,32-/m0/s1 |
| InChIKey | VRUHQYSVBRDWSH-ACHIHNKUSA-N |
| XLogP | 9.20 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.71 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|