C22H22O4 — CID 101422406
(3R,4R,5R)-4-[(4-methoxyphenyl)methoxy]-5-[(E)-4-phenylbut-1-en-3-ynyl]oxolan-3-ol (PubChem CID 101422406) has the molecular formula C22H22O4 and a molecular weight of 350.41 g/mol. Its IUPAC name is (3R,4R,5R)-4-[(4-methoxyphenyl)methoxy]-5-[(E)-4-phenylbut-1-en-3-ynyl]oxolan-3-ol.
| Compound Name | (3R,4R,5R)-4-[(4-methoxyphenyl)methoxy]-5-[(E)-4-phenylbut-1-en-3-ynyl]oxolan-3-ol |
|---|---|
| PubChem CID | 101422406 |
| Molecular Formula | C22H22O4 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | (3R,4R,5R)-4-[(4-methoxyphenyl)methoxy]-5-[(E)-4-phenylbut-1-en-3-ynyl]oxolan-3-ol |
| SMILES | COc1ccc(CO[C@@H]2[C@H](O)CO[C@@H]2/C=C/C#Cc2ccccc2)cc1 |
| InChI | InChI=1S/C22H22O4/c1-24-19-13-11-18(12-14-19)15-26-22-20(23)16-25-21(22)10-6-5-9-17-7-3-2-4-8-17/h2-4,6-8,10-14,20-23H,15-16H2,1H3/b10-6+/t20-,21-,22-/m1/s1 |
| InChIKey | MCHZNOYVQBHWGK-URDCNTCWSA-N |
| XLogP | 2.95 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|