C38H50N10O4S2 — CID 102265397
4-[[4-[[8-[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]sulfonyl-1,4,8,11-tetrazacyclotetradec-1-yl]sulfonyl]phenyl]diazenyl]-N,N-dimethylaniline (PubChem CID 102265397) has the molecular formula C38H50N10O4S2 and a molecular weight of 775.02 g/mol. Its IUPAC name is 4-[[4-[[8-[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]sulfonyl-1,4,8,11-tetrazacyclotetradec-1-yl]sulfonyl]phenyl]diazenyl]-N,N-dimethylaniline.
| Compound Name | 4-[[4-[[8-[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]sulfonyl-1,4,8,11-tetrazacyclotetradec-1-yl]sulfonyl]phenyl]diazenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 102265397 |
| Molecular Formula | C38H50N10O4S2 |
| Molecular Weight | 775.02 g/mol |
| Exact Mass | 774.35 |
| IUPAC Name | 4-[[4-[[8-[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]sulfonyl-1,4,8,11-tetrazacyclotetradec-1-yl]sulfonyl]phenyl]diazenyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/N=N/c2ccc(S(=O)(=O)N3CCCNCCN(S(=O)(=O)c4ccc(/N=N/c5ccc(N(C)C)cc5)cc4)CCCNCC3)cc2)cc1 |
| InChI | InChI=1S/C38H50N10O4S2/c1-45(2)35-15-7-31(8-16-35)41-43-33-11-19-37(20-12-33)53(49,50)47-27-5-23-40-26-30-48(28-6-24-39-25-29-47)54(51,52)38-21-13-34(14-22-38)44-42-32-9-17-36(18-10-32)46(3)4/h7-22,39-40H,5-6,23-30H2,1-4H3/b43-41+,44-42+ |
| InChIKey | WEWFAWJSUYPORJ-CHQNLTHESA-N |
| XLogP | 6.30 |
| TPSA | 154.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.02 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|