C20H29NO3S2Si — CID 102267779
[(2R,3R,6R)-3-(1,3-benzothiazol-2-ylsulfanyl)-2-methoxy-3,6-dihydro-2H-pyran-6-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 102267779) has the molecular formula C20H29NO3S2Si and a molecular weight of 423.68 g/mol. Its IUPAC name is [(2R,3R,6R)-3-(1,3-benzothiazol-2-ylsulfanyl)-2-methoxy-3,6-dihydro-2H-pyran-6-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(2R,3R,6R)-3-(1,3-benzothiazol-2-ylsulfanyl)-2-methoxy-3,6-dihydro-2H-pyran-6-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 102267779 |
| Molecular Formula | C20H29NO3S2Si |
| Molecular Weight | 423.68 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | [(2R,3R,6R)-3-(1,3-benzothiazol-2-ylsulfanyl)-2-methoxy-3,6-dihydro-2H-pyran-6-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CO[C@@H]1O[C@@H](CO[Si](C)(C)C(C)(C)C)C=C[C@H]1Sc1nc2ccccc2s1 |
| InChI | InChI=1S/C20H29NO3S2Si/c1-20(2,3)27(5,6)23-13-14-11-12-17(18(22-4)24-14)26-19-21-15-9-7-8-10-16(15)25-19/h7-12,14,17-18H,13H2,1-6H3/t14-,17-,18-/m1/s1 |
| InChIKey | NHHLJFHWDQSNKN-ZTFGCOKTSA-N |
| XLogP | 5.71 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.68 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|