C22H32N2O2S — CID 102521736
N-[(1R,2R)-2-(3-cyclohexa-1,4-dien-1-ylpropylamino)cyclohexyl]-4-methylbenzenesulfonamide (PubChem CID 102521736) has the molecular formula C22H32N2O2S and a molecular weight of 388.58 g/mol. Its IUPAC name is N-[(1R,2R)-2-(3-cyclohexa-1,4-dien-1-ylpropylamino)cyclohexyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(1R,2R)-2-(3-cyclohexa-1,4-dien-1-ylpropylamino)cyclohexyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 102521736 |
| Molecular Formula | C22H32N2O2S |
| Molecular Weight | 388.58 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | N-[(1R,2R)-2-(3-cyclohexa-1,4-dien-1-ylpropylamino)cyclohexyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H]2CCCC[C@H]2NCCCC2=CCC=CC2)cc1 |
| InChI | InChI=1S/C22H32N2O2S/c1-18-13-15-20(16-14-18)27(25,26)24-22-12-6-5-11-21(22)23-17-7-10-19-8-3-2-4-9-19/h2-3,9,13-16,21-24H,4-8,10-12,17H2,1H3/t21-,22-/m1/s1 |
| InChIKey | BTGLOXQKMQXCCQ-FGZHOGPDSA-N |
| XLogP | 4.23 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.58 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|