C14H16O4S — CID 10423788
(3aS,7aR)-7a-(benzenesulfonyl)-3,3a,4,5,6,7-hexahydro-2-benzofuran-1-one (PubChem CID 10423788) has the molecular formula C14H16O4S and a molecular weight of 280.34 g/mol. Its IUPAC name is (3aS,7aR)-7a-(benzenesulfonyl)-3,3a,4,5,6,7-hexahydro-2-benzofuran-1-one.
| Compound Name | (3aS,7aR)-7a-(benzenesulfonyl)-3,3a,4,5,6,7-hexahydro-2-benzofuran-1-one |
|---|---|
| PubChem CID | 10423788 |
| Molecular Formula | C14H16O4S |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | (3aS,7aR)-7a-(benzenesulfonyl)-3,3a,4,5,6,7-hexahydro-2-benzofuran-1-one |
| SMILES | O=C1OC[C@@H]2CCCC[C@]12S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H16O4S/c15-13-14(9-5-4-6-11(14)10-18-13)19(16,17)12-7-2-1-3-8-12/h1-3,7-8,11H,4-6,9-10H2/t11-,14+/m0/s1 |
| InChIKey | JRHQHCGJRVUJEN-SMDDNHRTSA-N |
| XLogP | 1.95 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |