C28H37NO5Si — CID 10601307
ethyl (4R,5S)-4-[tert-butyl(diphenyl)silyl]oxy-5-(4-methylpent-4-enyl)-2-oxido-4,5-dihydro-1,2-oxazol-2-ium-3-carboxylate (PubChem CID 10601307) has the molecular formula C28H37NO5Si and a molecular weight of 495.69 g/mol. Its IUPAC name is ethyl (4R,5S)-4-[tert-butyl(diphenyl)silyl]oxy-5-(4-methylpent-4-enyl)-2-oxido-4,5-dihydro-1,2-oxazol-2-ium-3-carboxylate.
| Compound Name | ethyl (4R,5S)-4-[tert-butyl(diphenyl)silyl]oxy-5-(4-methylpent-4-enyl)-2-oxido-4,5-dihydro-1,2-oxazol-2-ium-3-carboxylate |
|---|---|
| PubChem CID | 10601307 |
| Molecular Formula | C28H37NO5Si |
| Molecular Weight | 495.69 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | ethyl (4R,5S)-4-[tert-butyl(diphenyl)silyl]oxy-5-(4-methylpent-4-enyl)-2-oxido-4,5-dihydro-1,2-oxazol-2-ium-3-carboxylate |
| SMILES | C=C(C)CCC[C@@H]1O[N+]([O-])=C(C(=O)OCC)[C@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H37NO5Si/c1-7-32-27(30)25-26(24(33-29(25)31)20-14-15-21(2)3)34-35(28(4,5)6,22-16-10-8-11-17-22)23-18-12-9-13-19-23/h8-13,16-19,24,26H,2,7,14-15,20H2,1,3-6H3/t24-,26-/m0/s1 |
| InChIKey | SGZFFLJGCWERHA-AHWVRZQESA-N |
| XLogP | 4.51 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.69 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|