C34H65NO6SSi3 — CID 10628505
[(2S,3R,4R,5R,6R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-ethylsulfanyloxan-3-yl] N-benzylcarbamate (PubChem CID 10628505) has the molecular formula C34H65NO6SSi3 and a molecular weight of 700.22 g/mol. Its IUPAC name is [(2S,3R,4R,5R,6R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-ethylsulfanyloxan-3-yl] N-benzylcarbamate.
| Compound Name | [(2S,3R,4R,5R,6R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-ethylsulfanyloxan-3-yl] N-benzylcarbamate |
|---|---|
| PubChem CID | 10628505 |
| Molecular Formula | C34H65NO6SSi3 |
| Molecular Weight | 700.22 g/mol |
| Exact Mass | 699.38 |
| IUPAC Name | [(2S,3R,4R,5R,6R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-ethylsulfanyloxan-3-yl] N-benzylcarbamate |
| SMILES | CCS[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1OC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C34H65NO6SSi3/c1-17-42-30-29(39-31(36)35-23-25-21-19-18-20-22-25)28(41-45(15,16)34(8,9)10)27(40-44(13,14)33(5,6)7)26(38-30)24-37-43(11,12)32(2,3)4/h18-22,26-30H,17,23-24H2,1-16H3,(H,35,36)/t26-,27-,28+,29-,30+/m1/s1 |
| InChIKey | VTBWEHMOXCNBSJ-RLXMVLCYSA-N |
| XLogP | 9.56 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.22 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|