C18H28N2O4S — CID 108509114
N'-[1-(1-adamantyl)ethyl]-N-(1,1-dioxothiolan-3-yl)oxamide (PubChem CID 108509114) has the molecular formula C18H28N2O4S and a molecular weight of 368.50 g/mol. Its IUPAC name is N'-[1-(1-adamantyl)ethyl]-N-(1,1-dioxothiolan-3-yl)oxamide.
| Compound Name | N'-[1-(1-adamantyl)ethyl]-N-(1,1-dioxothiolan-3-yl)oxamide |
|---|---|
| PubChem CID | 108509114 |
| Molecular Formula | C18H28N2O4S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | N'-[1-(1-adamantyl)ethyl]-N-(1,1-dioxothiolan-3-yl)oxamide |
| SMILES | CC(NC(=O)C(=O)NC1CCS(=O)(=O)C1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C18H28N2O4S/c1-11(18-7-12-4-13(8-18)6-14(5-12)9-18)19-16(21)17(22)20-15-2-3-25(23,24)10-15/h11-15H,2-10H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | NOCVQIIXGKMEKD-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|