C28H39NO3SSi — CID 10994682
ethyl (3R)-3-[tert-butyl(diphenyl)silyl]oxy-3-[(2R,3R)-3-(1-methylsulfanylethenyl)pyrrolidin-2-yl]propanoate (PubChem CID 10994682) has the molecular formula C28H39NO3SSi and a molecular weight of 497.78 g/mol. Its IUPAC name is ethyl (3R)-3-[tert-butyl(diphenyl)silyl]oxy-3-[(2R,3R)-3-(1-methylsulfanylethenyl)pyrrolidin-2-yl]propanoate.
| Compound Name | ethyl (3R)-3-[tert-butyl(diphenyl)silyl]oxy-3-[(2R,3R)-3-(1-methylsulfanylethenyl)pyrrolidin-2-yl]propanoate |
|---|---|
| PubChem CID | 10994682 |
| Molecular Formula | C28H39NO3SSi |
| Molecular Weight | 497.78 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | ethyl (3R)-3-[tert-butyl(diphenyl)silyl]oxy-3-[(2R,3R)-3-(1-methylsulfanylethenyl)pyrrolidin-2-yl]propanoate |
| SMILES | C=C(SC)[C@@H]1CCN[C@H]1[C@@H](CC(=O)OCC)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H39NO3SSi/c1-7-31-26(30)20-25(27-24(18-19-29-27)21(2)33-6)32-34(28(3,4)5,22-14-10-8-11-15-22)23-16-12-9-13-17-23/h8-17,24-25,27,29H,2,7,18-20H2,1,3-6H3/t24-,25+,27+/m0/s1 |
| InChIKey | OVXDTEUXJIBZCP-ZWEKWIFMSA-N |
| XLogP | 4.74 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.78 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|