C27H40O2SSi — CID 11026864
tert-butyl-[(2R)-1-[(2R,3S)-3-tert-butyloxiran-2-yl]-4-methylsulfanylbutan-2-yl]oxy-diphenylsilane (PubChem CID 11026864) has the molecular formula C27H40O2SSi and a molecular weight of 456.77 g/mol. Its IUPAC name is tert-butyl-[(2R)-1-[(2R,3S)-3-tert-butyloxiran-2-yl]-4-methylsulfanylbutan-2-yl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[(2R)-1-[(2R,3S)-3-tert-butyloxiran-2-yl]-4-methylsulfanylbutan-2-yl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 11026864 |
| Molecular Formula | C27H40O2SSi |
| Molecular Weight | 456.77 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | tert-butyl-[(2R)-1-[(2R,3S)-3-tert-butyloxiran-2-yl]-4-methylsulfanylbutan-2-yl]oxy-diphenylsilane |
| SMILES | CSCC[C@@H](C[C@H]1O[C@H]1C(C)(C)C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H40O2SSi/c1-26(2,3)25-24(28-25)20-21(18-19-30-7)29-31(27(4,5)6,22-14-10-8-11-15-22)23-16-12-9-13-17-23/h8-17,21,24-25H,18-20H2,1-7H3/t21-,24+,25+/m0/s1 |
| InChIKey | ZKLLUMJPZKHMSA-FTBPSBKWSA-N |
| XLogP | 5.89 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.77 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|