C15H23F2IN4 — CID 111920834
3-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-ethyl-1,1-dimethylguanidine;hydroiodide (PubChem CID 111920834) has the molecular formula C15H23F2IN4 and a molecular weight of 424.28 g/mol. Its IUPAC name is 3-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-ethyl-1,1-dimethylguanidine;hydroiodide.
| Compound Name | 3-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-ethyl-1,1-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111920834 |
| Molecular Formula | C15H23F2IN4 |
| Molecular Weight | 424.28 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | 3-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-ethyl-1,1-dimethylguanidine;hydroiodide |
| SMILES | CC/N=C(/NC1CCN(c2ccc(F)cc2F)C1)N(C)C.I |
| InChI | InChI=1S/C15H22F2N4.HI/c1-4-18-15(20(2)3)19-12-7-8-21(10-12)14-6-5-11(16)9-13(14)17;/h5-6,9,12H,4,7-8,10H2,1-3H3,(H,18,19);1H |
| InChIKey | QCEVTDVHXAAAHW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.28 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|